About 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one
1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one (PubChem CID 116985878) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one |
| PubChem CID | 116985878 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one |
| SMILES | CC(=O)Cc1ccc2[nH]c3ccncc3c2c1 |
| InChI | InChI=1S/C14H12N2O/c1-9(17)6-10-2-3-13-11(7-10)12-8-15-5-4-14(12)16-13/h2-5,7-8,16H,6H2,1H3 |
| InChIKey | KKURDWSJVVJRGC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one?
The IUPAC name of 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one (CID 116985878) is 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one.
What is the SMILES notation for 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one?
The canonical SMILES for 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one is CC(=O)Cc1ccc2[nH]c3ccncc3c2c1.
What is the InChIKey of 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one?
The InChIKey is KKURDWSJVVJRGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c1-9(17)6-10-2-3-13-11(7-10)12-8-15-5-4-14(12)16-13/h2-5,7-8,16H,6H2,1H3.
What are the key properties of 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one?
1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one has a molecular weight of 224.26 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5H-pyrido[4,3-b]indol-8-yl)propan-2-one is sourced from PubChem (CID 116985878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).