About 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol
3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol (PubChem CID 116986132) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol.
Molecular Properties
| Compound Name | 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol |
| PubChem CID | 116986132 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol |
| SMILES | CC(C)C(CO)c1ccc2c(c1)[nH]c1ccncc12 |
| InChI | InChI=1S/C16H18N2O/c1-10(2)14(9-19)11-3-4-12-13-8-17-6-5-15(13)18-16(12)7-11/h3-8,10,14,18-19H,9H2,1-2H3 |
| InChIKey | BPHBWDNNWAYEKN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol?
The IUPAC name of 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol (CID 116986132) is 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol.
What is the SMILES notation for 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol?
The canonical SMILES for 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol is CC(C)C(CO)c1ccc2c(c1)[nH]c1ccncc12.
What is the InChIKey of 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol?
The InChIKey is BPHBWDNNWAYEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-10(2)14(9-19)11-3-4-12-13-8-17-6-5-15(13)18-16(12)7-11/h3-8,10,14,18-19H,9H2,1-2H3.
What are the key properties of 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol?
3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol has a molecular weight of 254.33 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(5H-pyrido[4,3-b]indol-7-yl)butan-1-ol is sourced from PubChem (CID 116986132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).