About 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol
3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol (PubChem CID 116986926) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol.
Molecular Properties
| Compound Name | 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol |
| PubChem CID | 116986926 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol |
| SMILES | CC(C)C(CO)C12OCC(CO1)CO2 |
| InChI | InChI=1S/C10H18O4/c1-7(2)9(3-11)10-12-4-8(5-13-10)6-14-10/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | GAPLQWHDVYLNAN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol?
The IUPAC name of 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol (CID 116986926) is 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol.
What is the SMILES notation for 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol?
The canonical SMILES for 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol is CC(C)C(CO)C12OCC(CO1)CO2.
What is the InChIKey of 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol?
The InChIKey is GAPLQWHDVYLNAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-7(2)9(3-11)10-12-4-8(5-13-10)6-14-10/h7-9,11H,3-6H2,1-2H3.
What are the key properties of 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol?
3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol has a molecular weight of 202.25 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(2,6,7-trioxabicyclo[2.2.2]octan-1-yl)butan-1-ol is sourced from PubChem (CID 116986926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).