About methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate
methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate (PubChem CID 11698721) has the molecular formula C22H29NO7S2
and a molecular weight of 483.61 g/mol. Its IUPAC name is methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate |
| PubChem CID | 11698721 |
| Molecular Formula | C22H29NO7S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)NC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C22H29NO7S2/c1-14(24)29-19-9-8-16(13-20(19)30-15(2)25)12-18(22(27)28-3)23-21(26)7-5-4-6-17-10-11-31-32-17/h8-9,13,17-18H,4-7,10-12H2,1-3H3,(H,23,26)/t17-,18+/m1/s1 |
| InChIKey | SMJPKKTWKMONJW-MSOLQXFVSA-N |
| XLogP | 3.45 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate?
The IUPAC name of methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate (CID 11698721) is methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate.
What is the SMILES notation for methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate?
The canonical SMILES for methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate is COC(=O)[C@H](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)NC(=O)CCCC[C@@H]1CCSS1.
What is the InChIKey of methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate?
The InChIKey is SMJPKKTWKMONJW-MSOLQXFVSA-N. The full InChI is InChI=1S/C22H29NO7S2/c1-14(24)29-19-9-8-16(13-20(19)30-15(2)25)12-18(22(27)28-3)23-21(26)7-5-4-6-17-10-11-31-32-17/h8-9,13,17-18H,4-7,10-12H2,1-3H3,(H,23,26)/t17-,18+/m1/s1.
What are the key properties of methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate?
methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate has a molecular weight of 483.61 g/mol, XLogP of 3.45, 11 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]propanoate is sourced from PubChem (CID 11698721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).