About 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile
8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile (PubChem CID 116989824) has the molecular formula C8H6N4
and a molecular weight of 158.16 g/mol. Its IUPAC name is 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile |
| PubChem CID | 116989824 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile |
| SMILES | Cc1cccn2nc(C#N)nc12 |
| InChI | InChI=1S/C8H6N4/c1-6-3-2-4-12-8(6)10-7(5-9)11-12/h2-4H,1H3 |
| InChIKey | KKBVPSNKBYBGGT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile?
The IUPAC name of 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile (CID 116989824) is 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile.
What is the SMILES notation for 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile?
The canonical SMILES for 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is Cc1cccn2nc(C#N)nc12.
What is the InChIKey of 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile?
The InChIKey is KKBVPSNKBYBGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4/c1-6-3-2-4-12-8(6)10-7(5-9)11-12/h2-4H,1H3.
What are the key properties of 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile?
8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile has a molecular weight of 158.16 g/mol, XLogP of 0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile is sourced from PubChem (CID 116989824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).