C12H15BrN4O2 — CID 116990795
6-bromo-2-(4-methylpiperazin-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 116990795) has the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 6-bromo-2-(4-methylpiperazin-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-bromo-2-(4-methylpiperazin-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 116990795 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 6-bromo-2-(4-methylpiperazin-2-yl)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CN1CCNC(C2Oc3ccc(Br)nc3NC2=O)C1 |
| InChI | InChI=1S/C12H15BrN4O2/c1-17-5-4-14-7(6-17)10-12(18)16-11-8(19-10)2-3-9(13)15-11/h2-3,7,10,14H,4-6H2,1H3,(H,15,16,18) |
| InChIKey | OLWNAAMLPZWQBE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|