C15H14N2O2 — CID 116990980
2-(3-aminophenyl)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 116990980) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(3-aminophenyl)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 2-(3-aminophenyl)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116990980 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(3-aminophenyl)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)C(c2cccc(N)c2)Oc2ccccc21 |
| InChI | InChI=1S/C15H14N2O2/c1-17-12-7-2-3-8-13(12)19-14(15(17)18)10-5-4-6-11(16)9-10/h2-9,14H,16H2,1H3 |
| InChIKey | YBRYBNCFWJIAPG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|