About 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol
1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol (PubChem CID 116991251) has the molecular formula C8H16F2N2O
and a molecular weight of 194.22 g/mol. Its IUPAC name is 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol |
| PubChem CID | 116991251 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol |
| SMILES | NCC(O)CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H16F2N2O/c9-8(10)1-3-12(4-2-8)6-7(13)5-11/h7,13H,1-6,11H2 |
| InChIKey | GFUAXYOJNYOLBR-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol?
The IUPAC name of 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol (CID 116991251) is 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol.
What is the SMILES notation for 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol?
The canonical SMILES for 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol is NCC(O)CN1CCC(F)(F)CC1.
What is the InChIKey of 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol?
The InChIKey is GFUAXYOJNYOLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O/c9-8(10)1-3-12(4-2-8)6-7(13)5-11/h7,13H,1-6,11H2.
What are the key properties of 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol?
1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol has a molecular weight of 194.22 g/mol, XLogP of 0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(4,4-difluoropiperidin-1-yl)propan-2-ol is sourced from PubChem (CID 116991251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).