About [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol
[1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol (PubChem CID 116991256) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol |
| PubChem CID | 116991256 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol |
| SMILES | OCC1(CN2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C10H17F2NO/c11-10(12)3-5-13(6-4-10)7-9(8-14)1-2-9/h14H,1-8H2 |
| InChIKey | DWLUNMSQZOGXFR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol?
The IUPAC name of [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol (CID 116991256) is [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol.
What is the SMILES notation for [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol?
The canonical SMILES for [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol is OCC1(CN2CCC(F)(F)CC2)CC1.
What is the InChIKey of [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol?
The InChIKey is DWLUNMSQZOGXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO/c11-10(12)3-5-13(6-4-10)7-9(8-14)1-2-9/h14H,1-8H2.
What are the key properties of [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol?
[1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol has a molecular weight of 205.25 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4,4-difluoropiperidin-1-yl)methyl]cyclopropyl]methanol is sourced from PubChem (CID 116991256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).