About 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine
3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine (PubChem CID 116991612) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine |
| PubChem CID | 116991612 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine |
| SMILES | FC1(F)CCN(CCC2COCCN2)C1 |
| InChI | InChI=1S/C10H18F2N2O/c11-10(12)2-5-14(8-10)4-1-9-7-15-6-3-13-9/h9,13H,1-8H2 |
| InChIKey | USVNUNLSMZTHEW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine?
The IUPAC name of 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine (CID 116991612) is 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine.
What is the SMILES notation for 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine?
The canonical SMILES for 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine is FC1(F)CCN(CCC2COCCN2)C1.
What is the InChIKey of 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine?
The InChIKey is USVNUNLSMZTHEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c11-10(12)2-5-14(8-10)4-1-9-7-15-6-3-13-9/h9,13H,1-8H2.
What are the key properties of 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine?
3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine has a molecular weight of 220.26 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]morpholine is sourced from PubChem (CID 116991612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).