About 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one
3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one (PubChem CID 116991756) has the molecular formula C7H12F2N2O2
and a molecular weight of 194.18 g/mol. Its IUPAC name is 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one |
| PubChem CID | 116991756 |
| Molecular Formula | C7H12F2N2O2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one |
| SMILES | NCC(O)C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C7H12F2N2O2/c8-7(9)1-2-11(4-7)6(13)5(12)3-10/h5,12H,1-4,10H2 |
| InChIKey | KUHTXCQPUHFOCF-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one?
The IUPAC name of 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one (CID 116991756) is 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one.
What is the SMILES notation for 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one?
The canonical SMILES for 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one is NCC(O)C(=O)N1CCC(F)(F)C1.
What is the InChIKey of 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one?
The InChIKey is KUHTXCQPUHFOCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2O2/c8-7(9)1-2-11(4-7)6(13)5(12)3-10/h5,12H,1-4,10H2.
What are the key properties of 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one?
3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one has a molecular weight of 194.18 g/mol, XLogP of -0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(3,3-difluoropyrrolidin-1-yl)-2-hydroxypropan-1-one is sourced from PubChem (CID 116991756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).