About [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol
[3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol (PubChem CID 116992101) has the molecular formula C14H18F2O2
and a molecular weight of 256.29 g/mol. Its IUPAC name is [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol |
| PubChem CID | 116992101 |
| Molecular Formula | C14H18F2O2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol |
| SMILES | CC(C)C(F)(F)c1ccc(C2(CO)COC2)cc1 |
| InChI | InChI=1S/C14H18F2O2/c1-10(2)14(15,16)12-5-3-11(4-6-12)13(7-17)8-18-9-13/h3-6,10,17H,7-9H2,1-2H3 |
| InChIKey | IXTDWYZTSVUERO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol?
The IUPAC name of [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol (CID 116992101) is [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol.
What is the SMILES notation for [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol?
The canonical SMILES for [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol is CC(C)C(F)(F)c1ccc(C2(CO)COC2)cc1.
What is the InChIKey of [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol?
The InChIKey is IXTDWYZTSVUERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2O2/c1-10(2)14(15,16)12-5-3-11(4-6-12)13(7-17)8-18-9-13/h3-6,10,17H,7-9H2,1-2H3.
What are the key properties of [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol?
[3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol has a molecular weight of 256.29 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(1,1-difluoro-2-methylpropyl)phenyl]oxetan-3-yl]methanol is sourced from PubChem (CID 116992101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).