About CID 11699275
CID 11699275 (PubChem CID 11699275) has the molecular formula C21H26
and a molecular weight of 278.44 g/mol.
Molecular Properties
| Compound Name | CID 11699275 |
| PubChem CID | 11699275 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | — |
| SMILES | CCCCC1(CCCC)C([C]2[CH][CH][CH][CH]2)=C1[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C21H26/c1-3-5-15-21(16-6-4-2)19(17-11-7-8-12-17)20(21)18-13-9-10-14-18/h7-14H,3-6,15-16H2,1-2H3 |
| InChIKey | ZMEIIEXIMLUPGF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11699275 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11699275?
The IUPAC name of CID 11699275 (CID 11699275) is not available.
What is the SMILES notation for CID 11699275?
The canonical SMILES for CID 11699275 is CCCCC1(CCCC)C([C]2[CH][CH][CH][CH]2)=C1[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 11699275?
The InChIKey is ZMEIIEXIMLUPGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26/c1-3-5-15-21(16-6-4-2)19(17-11-7-8-12-17)20(21)18-13-9-10-14-18/h7-14H,3-6,15-16H2,1-2H3.
What are the key properties of CID 11699275?
CID 11699275 has a molecular weight of 278.44 g/mol, XLogP of 5.47, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11699275 is sourced from PubChem (CID 11699275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).