C11H13N3 — CID 116993073
N-(imidazo[1,5-a]pyridin-3-ylmethyl)cyclopropanamine (PubChem CID 116993073) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is N-(imidazo[1,5-a]pyridin-3-ylmethyl)cyclopropanamine.
| Compound Name | N-(imidazo[1,5-a]pyridin-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 116993073 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N-(imidazo[1,5-a]pyridin-3-ylmethyl)cyclopropanamine |
| SMILES | c1ccn2c(CNC3CC3)ncc2c1 |
| InChI | InChI=1S/C11H13N3/c1-2-6-14-10(3-1)7-13-11(14)8-12-9-4-5-9/h1-3,6-7,9,12H,4-5,8H2 |
| InChIKey | JSIRGGYPTDEFLD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |