C25H22ClF3N6O2 — CID 11699382
[[5-(4-chlorophenyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazol-2-yl]-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]methylidene]cyanamide (PubChem CID 11699382) has the molecular formula C25H22ClF3N6O2 and a molecular weight of 530.94 g/mol. Its IUPAC name is [[5-(4-chlorophenyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazol-2-yl]-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]methylidene]cyanamide.
| Compound Name | [[5-(4-chlorophenyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazol-2-yl]-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]methylidene]cyanamide |
|---|---|
| PubChem CID | 11699382 |
| Molecular Formula | C25H22ClF3N6O2 |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | [[5-(4-chlorophenyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazol-2-yl]-[3-[3-(trifluoromethyl)phenoxy]azetidin-1-yl]methylidene]cyanamide |
| SMILES | N#C/N=C(\N1CC(Oc2cccc(C(F)(F)F)c2)C1)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C25H22ClF3N6O2/c26-18-8-6-16(7-9-18)23-21(34-10-2-5-22(34)36)14-35(32-23)24(31-15-30)33-12-20(13-33)37-19-4-1-3-17(11-19)25(27,28)29/h1,3-4,6-9,11,20-21H,2,5,10,12-14H2/b31-24+ |
| InChIKey | DQQXSKOXZIAQIO-QFMPWRQOSA-N |
| XLogP | 3.97 |
| TPSA | 84.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|