C14H15NO2 — CID 116995233
3-isoquinolin-1-yl-2,2-dimethylpropanoic acid (PubChem CID 116995233) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-isoquinolin-1-yl-2,2-dimethylpropanoic acid.
| Compound Name | 3-isoquinolin-1-yl-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 116995233 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-isoquinolin-1-yl-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1nccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H15NO2/c1-14(2,13(16)17)9-12-11-6-4-3-5-10(11)7-8-15-12/h3-8H,9H2,1-2H3,(H,16,17) |
| InChIKey | ATTNQYLVJLYPFO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |