C30H31N5O3S — CID 11699526
11-[4-(3,4-dimethoxyphenyl)phenyl]-6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11699526) has the molecular formula C30H31N5O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is 11-[4-(3,4-dimethoxyphenyl)phenyl]-6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-[4-(3,4-dimethoxyphenyl)phenyl]-6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11699526 |
| Molecular Formula | C30H31N5O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 11-[4-(3,4-dimethoxyphenyl)phenyl]-6-ethoxy-13-methyl-4-piperazin-1-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3ccc(-c4ccc(OC)c(OC)c4)cc3)cc(C)c12 |
| InChI | InChI=1S/C30H31N5O3S/c1-5-38-28-27-26(33-30(34-28)35-14-12-31-13-15-35)25-18(2)16-22(32-29(25)39-27)20-8-6-19(7-9-20)21-10-11-23(36-3)24(17-21)37-4/h6-11,16-17,31H,5,12-15H2,1-4H3 |
| InChIKey | PCCUSUCTFOWEKN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |