C14H18ClNO2 — CID 116995853
6-(2-chloroethyl)-7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline (PubChem CID 116995853) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-(2-chloroethyl)-7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline.
| Compound Name | 6-(2-chloroethyl)-7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 116995853 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-(2-chloroethyl)-7-methyl-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinoline |
| SMILES | CN1CCc2cc3c(cc2C1CCCl)OCCO3 |
| InChI | InChI=1S/C14H18ClNO2/c1-16-5-3-10-8-13-14(18-7-6-17-13)9-11(10)12(16)2-4-15/h8-9,12H,2-7H2,1H3 |
| InChIKey | VTKPBQHLXKOECH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|