C30H24FN7O3 — CID 11699595
1-(8-fluoro-5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 11699595) has the molecular formula C30H24FN7O3 and a molecular weight of 549.57 g/mol. Its IUPAC name is 1-(8-fluoro-5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(8-fluoro-5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 11699595 |
| Molecular Formula | C30H24FN7O3 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 1-(8-fluoro-5-phenyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-2-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C)n2)c2[nH]cc(C(=O)C(=O)N3CCc4c(c5cc(F)ccc5n4-c4ccccc4)C3)c12 |
| InChI | InChI=1S/C30H24FN7O3/c1-17-34-16-37(35-17)29-27-26(25(41-2)14-33-29)21(13-32-27)28(39)30(40)36-11-10-24-22(15-36)20-12-18(31)8-9-23(20)38(24)19-6-4-3-5-7-19/h3-9,12-14,16,32H,10-11,15H2,1-2H3 |
| InChIKey | FKTZLRNGEXLURJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|