About 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione
5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 116996000) has the molecular formula C6H11N3OS
and a molecular weight of 173.24 g/mol. Its IUPAC name is 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione.
Molecular Properties
| Compound Name | 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione |
| PubChem CID | 116996000 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CC(N)CCc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C6H11N3OS/c1-4(7)2-3-5-8-9-6(11)10-5/h4H,2-3,7H2,1H3,(H,9,11) |
| InChIKey | RNWVGQSOBDPUJJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione?
The IUPAC name of 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione (CID 116996000) is 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione.
What is the SMILES notation for 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione?
The canonical SMILES for 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione is CC(N)CCc1n[nH]c(=S)o1.
What is the InChIKey of 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione?
The InChIKey is RNWVGQSOBDPUJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS/c1-4(7)2-3-5-8-9-6(11)10-5/h4H,2-3,7H2,1H3,(H,9,11).
What are the key properties of 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione?
5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione has a molecular weight of 173.24 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-aminobutyl)-3H-1,3,4-oxadiazole-2-thione is sourced from PubChem (CID 116996000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).