C32H29N3O6 — CID 11699617
5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-(9,10-dioxoanthracen-1-yl)pentanamide (PubChem CID 11699617) has the molecular formula C32H29N3O6 and a molecular weight of 551.60 g/mol. Its IUPAC name is 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-(9,10-dioxoanthracen-1-yl)pentanamide.
| Compound Name | 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-(9,10-dioxoanthracen-1-yl)pentanamide |
|---|---|
| PubChem CID | 11699617 |
| Molecular Formula | C32H29N3O6 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]-N-(9,10-dioxoanthracen-1-yl)pentanamide |
| SMILES | COc1cc2c(cc1OCCCCC(=O)Nc1cccc3c1C(=O)c1ccccc1C3=O)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C32H29N3O6/c1-40-26-16-23-25(33-18-19-8-7-14-35(19)32(23)39)17-27(26)41-15-5-4-13-28(36)34-24-12-6-11-22-29(24)31(38)21-10-3-2-9-20(21)30(22)37/h2-3,6,9-12,16-19H,4-5,7-8,13-15H2,1H3,(H,34,36)/t19-/m0/s1 |
| InChIKey | RPLCZGUZTHHZGC-IBGZPJMESA-N |
| XLogP | 4.98 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|