C21H21F3N4O7S2 — CID 11699720
N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-[(5S)-1,1,3-trioxo-1,2-thiazolidin-5-yl]phenyl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 11699720) has the molecular formula C21H21F3N4O7S2 and a molecular weight of 562.55 g/mol. Its IUPAC name is N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-[(5S)-1,1,3-trioxo-1,2-thiazolidin-5-yl]phenyl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-[(5S)-1,1,3-trioxo-1,2-thiazolidin-5-yl]phenyl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11699720 |
| Molecular Formula | C21H21F3N4O7S2 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | N-[(1S)-1-(1H-benzimidazol-2-yl)-2-[4-[(5S)-1,1,3-trioxo-1,2-thiazolidin-5-yl]phenyl]ethyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N[C@@H](Cc1ccc([C@@H]2CC(=O)NS2(=O)=O)cc1)c1nc2ccccc2[nH]1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H20N4O5S2.C2HF3O2/c1-29(25,26)22-16(19-20-14-4-2-3-5-15(14)21-19)10-12-6-8-13(9-7-12)17-11-18(24)23-30(17,27)28;3-2(4,5)1(6)7/h2-9,16-17,22H,10-11H2,1H3,(H,20,21)(H,23,24);(H,6,7)/t16-,17-;/m0./s1 |
| InChIKey | OHQNGRUNZKQPFI-QJHJCNPRSA-N |
| XLogP | 1.92 |
| TPSA | 175.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |