C15H17ClN2 — CID 116997859
N-[2-(2-chloro-3-methylquinolin-6-yl)ethyl]cyclopropanamine (PubChem CID 116997859) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is N-[2-(2-chloro-3-methylquinolin-6-yl)ethyl]cyclopropanamine.
| Compound Name | N-[2-(2-chloro-3-methylquinolin-6-yl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 116997859 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[2-(2-chloro-3-methylquinolin-6-yl)ethyl]cyclopropanamine |
| SMILES | Cc1cc2cc(CCNC3CC3)ccc2nc1Cl |
| InChI | InChI=1S/C15H17ClN2/c1-10-8-12-9-11(6-7-17-13-3-4-13)2-5-14(12)18-15(10)16/h2,5,8-9,13,17H,3-4,6-7H2,1H3 |
| InChIKey | DHJQNTPHCRMJAT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|