About 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline
3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline (PubChem CID 116998933) has the molecular formula C14H14N2S
and a molecular weight of 242.35 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline |
| PubChem CID | 116998933 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline |
| SMILES | Nc1cccc(-c2ccc3c(c2)SCCN3)c1 |
| InChI | InChI=1S/C14H14N2S/c15-12-3-1-2-10(8-12)11-4-5-13-14(9-11)17-7-6-16-13/h1-5,8-9,16H,6-7,15H2 |
| InChIKey | JNTQPGUEVQXATE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline?
The IUPAC name of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline (CID 116998933) is 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline.
What is the SMILES notation for 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline?
The canonical SMILES for 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline is Nc1cccc(-c2ccc3c(c2)SCCN3)c1.
What is the InChIKey of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline?
The InChIKey is JNTQPGUEVQXATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2S/c15-12-3-1-2-10(8-12)11-4-5-13-14(9-11)17-7-6-16-13/h1-5,8-9,16H,6-7,15H2.
What are the key properties of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline?
3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline has a molecular weight of 242.35 g/mol, XLogP of 3.45, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)aniline is sourced from PubChem (CID 116998933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).