C11H13NO2S — CID 116998950
2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)propanoic acid (PubChem CID 116998950) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)propanoic acid.
| Compound Name | 2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)propanoic acid |
|---|---|
| PubChem CID | 116998950 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C11H13NO2S/c1-7(11(13)14)8-2-3-9-10(6-8)15-5-4-12-9/h2-3,6-7,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | PJSPCTQVDQYEAW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |