About 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile
3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile (PubChem CID 116999004) has the molecular formula C12H12N2OS
and a molecular weight of 232.31 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile |
| PubChem CID | 116999004 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile |
| SMILES | N#CC1(c2ccc3c(c2)SCCN3)COC1 |
| InChI | InChI=1S/C12H12N2OS/c13-6-12(7-15-8-12)9-1-2-10-11(5-9)16-4-3-14-10/h1-2,5,14H,3-4,7-8H2 |
| InChIKey | UJGQILHNCUBYRW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile?
The IUPAC name of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile (CID 116999004) is 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile.
What is the SMILES notation for 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile?
The canonical SMILES for 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile is N#CC1(c2ccc3c(c2)SCCN3)COC1.
What is the InChIKey of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile?
The InChIKey is UJGQILHNCUBYRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2OS/c13-6-12(7-15-8-12)9-1-2-10-11(5-9)16-4-3-14-10/h1-2,5,14H,3-4,7-8H2.
What are the key properties of 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile?
3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile has a molecular weight of 232.31 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-1,4-benzothiazin-7-yl)oxetane-3-carbonitrile is sourced from PubChem (CID 116999004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).