C34H28F6N2O2 — CID 11700029
2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-8-phenoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 11700029) has the molecular formula C34H28F6N2O2 and a molecular weight of 610.60 g/mol. Its IUPAC name is 2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-8-phenoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-8-phenoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 11700029 |
| Molecular Formula | C34H28F6N2O2 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | 2-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethyl]-8-phenoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | FC(F)(F)c1cc(COCC(c2ccccc2)N2CCc3[nH]c4ccc(Oc5ccccc5)cc4c3C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H28F6N2O2/c35-33(36,37)24-15-22(16-25(17-24)34(38,39)40)20-43-21-32(23-7-3-1-4-8-23)42-14-13-31-29(19-42)28-18-27(11-12-30(28)41-31)44-26-9-5-2-6-10-26/h1-12,15-18,32,41H,13-14,19-21H2 |
| InChIKey | SJMGGTURXLCWCR-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|