About 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine
2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine (PubChem CID 117000301) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine |
| PubChem CID | 117000301 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCNC(c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C17H28N2/c1-17(2,3)14-8-6-13(7-9-14)16-12-15(19(4)5)10-11-18-16/h6-9,15-16,18H,10-12H2,1-5H3 |
| InChIKey | GYYGOIFQIITQEQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine?
The IUPAC name of 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine (CID 117000301) is 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine.
What is the SMILES notation for 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine?
The canonical SMILES for 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine is CN(C)C1CCNC(c2ccc(C(C)(C)C)cc2)C1.
What is the InChIKey of 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine?
The InChIKey is GYYGOIFQIITQEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-17(2,3)14-8-6-13(7-9-14)16-12-15(19(4)5)10-11-18-16/h6-9,15-16,18H,10-12H2,1-5H3.
What are the key properties of 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine?
2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine has a molecular weight of 260.43 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-N,N-dimethylpiperidin-4-amine is sourced from PubChem (CID 117000301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).