C13H11FN2O — CID 117000677
7-(2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine (PubChem CID 117000677) has the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 7-(2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 117000677 |
| Molecular Formula | C13H11FN2O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 7-(2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
| SMILES | Fc1ccccc1-c1cnc2c(c1)OCCN2 |
| InChI | InChI=1S/C13H11FN2O/c14-11-4-2-1-3-10(11)9-7-12-13(16-8-9)15-5-6-17-12/h1-4,7-8H,5-6H2,(H,15,16) |
| InChIKey | FIDYPEQQVNTDIW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |