C13H24N2O2 — CID 117002390
5-(2-aminoethyl)-3-cycloheptyl-1,3-oxazinan-2-one (PubChem CID 117002390) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-cycloheptyl-1,3-oxazinan-2-one.
| Compound Name | 5-(2-aminoethyl)-3-cycloheptyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117002390 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 5-(2-aminoethyl)-3-cycloheptyl-1,3-oxazinan-2-one |
| SMILES | NCCC1COC(=O)N(C2CCCCCC2)C1 |
| InChI | InChI=1S/C13H24N2O2/c14-8-7-11-9-15(13(16)17-10-11)12-5-3-1-2-4-6-12/h11-12H,1-10,14H2 |
| InChIKey | NIUFNUBCMZMCPY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |