C13H17BrN2O2 — CID 117002431
5-(2-aminoethyl)-3-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one (PubChem CID 117002431) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one.
| Compound Name | 5-(2-aminoethyl)-3-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117002431 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-(2-aminoethyl)-3-(2-bromo-4-methylphenyl)-1,3-oxazinan-2-one |
| SMILES | Cc1ccc(N2CC(CCN)COC2=O)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-9-2-3-12(11(14)6-9)16-7-10(4-5-15)8-18-13(16)17/h2-3,6,10H,4-5,7-8,15H2,1H3 |
| InChIKey | ZCRXKWOYKPTNQS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |