About 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one
3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one (PubChem CID 117002450) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one |
| PubChem CID | 117002450 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one |
| SMILES | CNCCC1COC(=O)N(CCCOC)C1 |
| InChI | InChI=1S/C11H22N2O3/c1-12-5-4-10-8-13(6-3-7-15-2)11(14)16-9-10/h10,12H,3-9H2,1-2H3 |
| InChIKey | UHRLONWLDHFNCQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one?
The IUPAC name of 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one (CID 117002450) is 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one.
What is the SMILES notation for 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one?
The canonical SMILES for 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one is CNCCC1COC(=O)N(CCCOC)C1.
What is the InChIKey of 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one?
The InChIKey is UHRLONWLDHFNCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-12-5-4-10-8-13(6-3-7-15-2)11(14)16-9-10/h10,12H,3-9H2,1-2H3.
What are the key properties of 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one?
3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one has a molecular weight of 230.31 g/mol, XLogP of 0.70, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxypropyl)-5-[2-(methylamino)ethyl]-1,3-oxazinan-2-one is sourced from PubChem (CID 117002450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).