C14H19N3O — CID 117003122
2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 117003122) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 117003122 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(pyridin-3-ylmethyl)-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(Cc2cccnc2)CCC12CCNCC2 |
| InChI | InChI=1S/C14H19N3O/c18-13-14(3-7-15-8-4-14)5-9-17(13)11-12-2-1-6-16-10-12/h1-2,6,10,15H,3-5,7-9,11H2 |
| InChIKey | OLBUUJNDYOEPRX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |