About 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile
1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile (PubChem CID 117003251) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile |
| PubChem CID | 117003251 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile |
| SMILES | CCCCCN1CC=C(C#N)CC1 |
| InChI | InChI=1S/C11H18N2/c1-2-3-4-7-13-8-5-11(10-12)6-9-13/h5H,2-4,6-9H2,1H3 |
| InChIKey | YCZLLZFDBGJGCR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile?
The IUPAC name of 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile (CID 117003251) is 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile.
What is the SMILES notation for 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile?
The canonical SMILES for 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile is CCCCCN1CC=C(C#N)CC1.
What is the InChIKey of 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile?
The InChIKey is YCZLLZFDBGJGCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-2-3-4-7-13-8-5-11(10-12)6-9-13/h5H,2-4,6-9H2,1H3.
What are the key properties of 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile?
1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile has a molecular weight of 178.28 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-3,6-dihydro-2H-pyridine-4-carbonitrile is sourced from PubChem (CID 117003251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).