C13H15ClFN3 — CID 117004802
2-[[1-(3-chloro-4-fluorophenyl)piperidin-3-yl]amino]acetonitrile (PubChem CID 117004802) has the molecular formula C13H15ClFN3 and a molecular weight of 267.73 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-fluorophenyl)piperidin-3-yl]amino]acetonitrile.
| Compound Name | 2-[[1-(3-chloro-4-fluorophenyl)piperidin-3-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 117004802 |
| Molecular Formula | C13H15ClFN3 |
| Molecular Weight | 267.73 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[[1-(3-chloro-4-fluorophenyl)piperidin-3-yl]amino]acetonitrile |
| SMILES | N#CCNC1CCCN(c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H15ClFN3/c14-12-8-11(3-4-13(12)15)18-7-1-2-10(9-18)17-6-5-16/h3-4,8,10,17H,1-2,6-7,9H2 |
| InChIKey | IJSGZOBXHRWBQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|