C43H29ClO11 — CID 11700546
acetyloxymethyl 3',6'-diacetyloxy-2'-chloro-7'-(10-methylanthracen-9-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-4-carboxylate (PubChem CID 11700546) has the molecular formula C43H29ClO11 and a molecular weight of 757.15 g/mol. Its IUPAC name is acetyloxymethyl 3',6'-diacetyloxy-2'-chloro-7'-(10-methylanthracen-9-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-4-carboxylate.
| Compound Name | acetyloxymethyl 3',6'-diacetyloxy-2'-chloro-7'-(10-methylanthracen-9-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-4-carboxylate |
|---|---|
| PubChem CID | 11700546 |
| Molecular Formula | C43H29ClO11 |
| Molecular Weight | 757.15 g/mol |
| Exact Mass | 756.14 |
| IUPAC Name | acetyloxymethyl 3',6'-diacetyloxy-2'-chloro-7'-(10-methylanthracen-9-yl)-1-oxospiro[2-benzofuran-3,9'-xanthene]-4-carboxylate |
| SMILES | CC(=O)OCOC(=O)c1cccc2c1C1(OC2=O)c2cc(Cl)c(OC(C)=O)cc2Oc2cc(OC(C)=O)c(-c3c4ccccc4c(C)c4ccccc34)cc21 |
| InChI | InChI=1S/C43H29ClO11/c1-21-25-10-5-7-12-27(25)39(28-13-8-6-11-26(21)28)31-16-32-36(18-35(31)52-23(3)46)54-37-19-38(53-24(4)47)34(44)17-33(37)43(32)40-29(41(48)51-20-50-22(2)45)14-9-15-30(40)42(49)55-43/h5-19H,20H2,1-4H3 |
| InChIKey | DHJAPYBJALGQPT-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.15 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|