About 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline
4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 117006767) has the molecular formula C14H13BrN2
and a molecular weight of 289.18 g/mol. Its IUPAC name is 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 117006767 |
| Molecular Formula | C14H13BrN2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | Brc1ccccc1N1CCNc2ccccc21 |
| InChI | InChI=1S/C14H13BrN2/c15-11-5-1-3-7-13(11)17-10-9-16-12-6-2-4-8-14(12)17/h1-8,16H,9-10H2 |
| InChIKey | UDMRFDRHGINVBS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline (CID 117006767) is 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline is Brc1ccccc1N1CCNc2ccccc21.
What is the InChIKey of 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline?
The InChIKey is UDMRFDRHGINVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2/c15-11-5-1-3-7-13(11)17-10-9-16-12-6-2-4-8-14(12)17/h1-8,16H,9-10H2.
What are the key properties of 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline?
4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline has a molecular weight of 289.18 g/mol, XLogP of 4.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromophenyl)-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 117006767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).