C10H17F2N — CID 117007575
1-cyclohexyl-3,3-difluoropyrrolidine (PubChem CID 117007575) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-cyclohexyl-3,3-difluoropyrrolidine.
| Compound Name | 1-cyclohexyl-3,3-difluoropyrrolidine |
|---|---|
| PubChem CID | 117007575 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-cyclohexyl-3,3-difluoropyrrolidine |
| SMILES | FC1(F)CCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C10H17F2N/c11-10(12)6-7-13(8-10)9-4-2-1-3-5-9/h9H,1-8H2 |
| InChIKey | IOLHEPLKAMWICS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |