About 1-tert-butylpiperidine-4,4-dicarboxylic acid
1-tert-butylpiperidine-4,4-dicarboxylic acid (PubChem CID 117007985) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-tert-butylpiperidine-4,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 1-tert-butylpiperidine-4,4-dicarboxylic acid |
| PubChem CID | 117007985 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-tert-butylpiperidine-4,4-dicarboxylic acid |
| SMILES | CC(C)(C)N1CCC(C(=O)O)(C(=O)O)CC1 |
| InChI | InChI=1S/C11H19NO4/c1-10(2,3)12-6-4-11(5-7-12,8(13)14)9(15)16/h4-7H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | VHCCDGOVSIVHHQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylpiperidine-4,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpiperidine-4,4-dicarboxylic acid?
The IUPAC name of 1-tert-butylpiperidine-4,4-dicarboxylic acid (CID 117007985) is 1-tert-butylpiperidine-4,4-dicarboxylic acid.
What is the SMILES notation for 1-tert-butylpiperidine-4,4-dicarboxylic acid?
The canonical SMILES for 1-tert-butylpiperidine-4,4-dicarboxylic acid is CC(C)(C)N1CCC(C(=O)O)(C(=O)O)CC1.
What is the InChIKey of 1-tert-butylpiperidine-4,4-dicarboxylic acid?
The InChIKey is VHCCDGOVSIVHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4/c1-10(2,3)12-6-4-11(5-7-12,8(13)14)9(15)16/h4-7H2,1-3H3,(H,13,14)(H,15,16).
What are the key properties of 1-tert-butylpiperidine-4,4-dicarboxylic acid?
1-tert-butylpiperidine-4,4-dicarboxylic acid has a molecular weight of 229.28 g/mol, XLogP of 1.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpiperidine-4,4-dicarboxylic acid is sourced from PubChem (CID 117007985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).