C11H19NO4 — CID 117007985
1-tert-butylpiperidine-4,4-dicarboxylic acid (PubChem CID 117007985) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-tert-butylpiperidine-4,4-dicarboxylic acid.
| Compound Name | 1-tert-butylpiperidine-4,4-dicarboxylic acid |
|---|---|
| PubChem CID | 117007985 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-tert-butylpiperidine-4,4-dicarboxylic acid |
| SMILES | CC(C)(C)N1CCC(C(=O)O)(C(=O)O)CC1 |
| InChI | InChI=1S/C11H19NO4/c1-10(2,3)12-6-4-11(5-7-12,8(13)14)9(15)16/h4-7H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | VHCCDGOVSIVHHQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|