3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid

C10H19NO4 — CID 117009385

IUPAC3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid
SMILESCOCCN1CCOCC1CCC(=O)O
InChIInChI=1S/C10H19NO4/c1-14-6-4-11-5-7-15-8-9(11)2-3-10(12)13/h9H,2-8H2,1H3,(H,12,13)
InChIKeyKNXOAYXBIJEQOR-UHFFFAOYSA-N
MW217.26 g/mol
LogP0.20
Rot. Bonds6

About 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid

3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid (PubChem CID 117009385) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid.

Molecular Properties

Compound Name3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid
PubChem CID117009385
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Name3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid
SMILESCOCCN1CCOCC1CCC(=O)O
InChIInChI=1S/C10H19NO4/c1-14-6-4-11-5-7-15-8-9(11)2-3-10(12)13/h9H,2-8H2,1H3,(H,12,13)
InChIKeyKNXOAYXBIJEQOR-UHFFFAOYSA-N
XLogP0.20
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(4-butylmorpholin-3-yl)propanoic acid
CID 117009382
3-ethyl-4-(2-methoxyethyl)morpholine
CID 157403746
4-(2-methoxyethyl)morpholine-3-carboxamide
CID 129061483
3-[4-[(4-methylphenyl)methyl]morpholin-3-yl]propanoic acid
CID 117009392
3-[(4-methylmorpholin-3-yl)methoxy]propanoic acid
CID 83819579
3-(4-tert-butylmorpholin-3-yl)propanoic acid
CID 117009398
3-[4-(oxolan-2-ylmethyl)morpholin-3-yl]propanoic acid
CID 117009387
3-[4-[(2-methylpropan-2-yl)oxycarbonyl]morpholin-3-yl]propanoic acid
CID 53425042
3-(3-methylmorpholin-4-yl)propanoic acid
CID 43542324
3-[4-(2-methoxyethyl)morpholin-2-yl]propanoic acid
CID 117008804
N-[[4-[2-(2-methoxyethoxy)ethyl]morpholin-3-yl]methyl]propan-1-amine
CID 83100581
3-[4-(4-methylphenyl)morpholin-3-yl]propanoic acid
CID 117009405

Frequently Asked Questions

What is the IUPAC name of 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid?
The IUPAC name of 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid (CID 117009385) is 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid.
What is the SMILES notation for 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid?
The canonical SMILES for 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid is COCCN1CCOCC1CCC(=O)O.
What is the InChIKey of 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid?
The InChIKey is KNXOAYXBIJEQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-14-6-4-11-5-7-15-8-9(11)2-3-10(12)13/h9H,2-8H2,1H3,(H,12,13).
What are the key properties of 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid?
3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid has a molecular weight of 217.26 g/mol, XLogP of 0.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid is sourced from PubChem (CID 117009385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).