C12H14ClNO3 — CID 117009999
ethyl 1-(5-chloro-2-methoxyphenyl)aziridine-2-carboxylate (PubChem CID 117009999) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is ethyl 1-(5-chloro-2-methoxyphenyl)aziridine-2-carboxylate.
| Compound Name | ethyl 1-(5-chloro-2-methoxyphenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 117009999 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | ethyl 1-(5-chloro-2-methoxyphenyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)C1CN1c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C12H14ClNO3/c1-3-17-12(15)10-7-14(10)9-6-8(13)4-5-11(9)16-2/h4-6,10H,3,7H2,1-2H3 |
| InChIKey | DUOCEBNUUHOXEH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|