C7H5NO4 — CID 11701104
5,7-dihydroxy-3H-1,3-benzoxazol-2-one (PubChem CID 11701104) has the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. Its IUPAC name is 5,7-dihydroxy-3H-1,3-benzoxazol-2-one.
| Compound Name | 5,7-dihydroxy-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 11701104 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 5,7-dihydroxy-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(O)cc(O)c2o1 |
| InChI | InChI=1S/C7H5NO4/c9-3-1-4-6(5(10)2-3)12-7(11)8-4/h1-2,9-10H,(H,8,11) |
| InChIKey | QSAFIXHOAUIWTE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |