About (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine
(3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine (PubChem CID 11701108) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine.
Molecular Properties
| Compound Name | (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine |
| PubChem CID | 11701108 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine |
| SMILES | C1=C[C@@H](C2CCCCC2)OOC1 |
| InChI | InChI=1S/C10H16O2/c1-2-5-9(6-3-1)10-7-4-8-11-12-10/h4,7,9-10H,1-3,5-6,8H2/t10-/m0/s1 |
| InChIKey | RCVRAHHTMNSHSE-JTQLQIEISA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine?
The IUPAC name of (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine (CID 11701108) is (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine.
What is the SMILES notation for (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine?
The canonical SMILES for (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine is C1=C[C@@H](C2CCCCC2)OOC1.
What is the InChIKey of (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine?
The InChIKey is RCVRAHHTMNSHSE-JTQLQIEISA-N. The full InChI is InChI=1S/C10H16O2/c1-2-5-9(6-3-1)10-7-4-8-11-12-10/h4,7,9-10H,1-3,5-6,8H2/t10-/m0/s1.
What are the key properties of (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine?
(3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine has a molecular weight of 168.24 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-cyclohexyl-3,6-dihydro-1,2-dioxine is sourced from PubChem (CID 11701108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).