C13H12N2O4 — CID 117011291
2-[3-(3-cyanophenyl)-2-oxo-1,3-oxazinan-4-yl]acetic acid (PubChem CID 117011291) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[3-(3-cyanophenyl)-2-oxo-1,3-oxazinan-4-yl]acetic acid.
| Compound Name | 2-[3-(3-cyanophenyl)-2-oxo-1,3-oxazinan-4-yl]acetic acid |
|---|---|
| PubChem CID | 117011291 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[3-(3-cyanophenyl)-2-oxo-1,3-oxazinan-4-yl]acetic acid |
| SMILES | N#Cc1cccc(N2C(=O)OCCC2CC(=O)O)c1 |
| InChI | InChI=1S/C13H12N2O4/c14-8-9-2-1-3-10(6-9)15-11(7-12(16)17)4-5-19-13(15)18/h1-3,6,11H,4-5,7H2,(H,16,17) |
| InChIKey | ZIALOCJOPQMZOF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |