About 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one
3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one (PubChem CID 117011507) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one |
| PubChem CID | 117011507 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one |
| SMILES | CN(C)CCCN1CC(CO)COC1=O |
| InChI | InChI=1S/C10H20N2O3/c1-11(2)4-3-5-12-6-9(7-13)8-15-10(12)14/h9,13H,3-8H2,1-2H3 |
| InChIKey | VWMIUPJKSRCTFX-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one?
The IUPAC name of 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one (CID 117011507) is 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one.
What is the SMILES notation for 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one?
The canonical SMILES for 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one is CN(C)CCCN1CC(CO)COC1=O.
What is the InChIKey of 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one?
The InChIKey is VWMIUPJKSRCTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-11(2)4-3-5-12-6-9(7-13)8-15-10(12)14/h9,13H,3-8H2,1-2H3.
What are the key properties of 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one?
3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one has a molecular weight of 216.28 g/mol, XLogP of -0.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(dimethylamino)propyl]-5-(hydroxymethyl)-1,3-oxazinan-2-one is sourced from PubChem (CID 117011507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).