C15H25N3 — CID 117012470
3-(aminomethyl)-1-(4-ethylphenyl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 117012470) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 3-(aminomethyl)-1-(4-ethylphenyl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 3-(aminomethyl)-1-(4-ethylphenyl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 117012470 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 3-(aminomethyl)-1-(4-ethylphenyl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CCc1ccc(N2CCC(CN)(N(C)C)C2)cc1 |
| InChI | InChI=1S/C15H25N3/c1-4-13-5-7-14(8-6-13)18-10-9-15(11-16,12-18)17(2)3/h5-8H,4,9-12,16H2,1-3H3 |
| InChIKey | IKSVSBXFYORQJJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|