About 4-chlorothieno[3,2-c]quinoline
4-chlorothieno[3,2-c]quinoline (PubChem CID 11701333) has the molecular formula C11H6ClNS
and a molecular weight of 219.70 g/mol. Its IUPAC name is 4-chlorothieno[3,2-c]quinoline.
Molecular Properties
| Compound Name | 4-chlorothieno[3,2-c]quinoline |
| PubChem CID | 11701333 |
| Molecular Formula | C11H6ClNS |
| Molecular Weight | 219.70 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 4-chlorothieno[3,2-c]quinoline |
| SMILES | Clc1nc2ccccc2c2sccc12 |
| InChI | InChI=1S/C11H6ClNS/c12-11-8-5-6-14-10(8)7-3-1-2-4-9(7)13-11/h1-6H |
| InChIKey | FFYFVQIUCOSRPH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorothieno[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorothieno[3,2-c]quinoline?
The IUPAC name of 4-chlorothieno[3,2-c]quinoline (CID 11701333) is 4-chlorothieno[3,2-c]quinoline.
What is the SMILES notation for 4-chlorothieno[3,2-c]quinoline?
The canonical SMILES for 4-chlorothieno[3,2-c]quinoline is Clc1nc2ccccc2c2sccc12.
What is the InChIKey of 4-chlorothieno[3,2-c]quinoline?
The InChIKey is FFYFVQIUCOSRPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClNS/c12-11-8-5-6-14-10(8)7-3-1-2-4-9(7)13-11/h1-6H.
What are the key properties of 4-chlorothieno[3,2-c]quinoline?
4-chlorothieno[3,2-c]quinoline has a molecular weight of 219.70 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorothieno[3,2-c]quinoline is sourced from PubChem (CID 11701333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).