(Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid

C11H22O3Si — CID 11701392

IUPAC(Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid
SMILESC[C@@H](/C=C\C(=O)O)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C11H22O3Si/c1-9(7-8-10(12)13)14-15(5,6)11(2,3)4/h7-9H,1-6H3,(H,12,13)/b8-7-/t9-/m0/s1
InChIKeyBQYJTPADGKWSNB-FUOZMLNRSA-N
MW230.38 g/mol
LogP3.04
Rot. Bonds4

About (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid

(Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid (PubChem CID 11701392) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid.

Molecular Properties

Compound Name(Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid
PubChem CID11701392
Molecular FormulaC11H22O3Si
Molecular Weight230.38 g/mol
Exact Mass230.13
IUPAC Name(Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid
SMILESC[C@@H](/C=C\C(=O)O)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C11H22O3Si/c1-9(7-8-10(12)13)14-15(5,6)11(2,3)4/h7-9H,1-6H3,(H,12,13)/b8-7-/t9-/m0/s1
InChIKeyBQYJTPADGKWSNB-FUOZMLNRSA-N
XLogP3.04
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.38
LogP ≤ 53.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid?
The IUPAC name of (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid (CID 11701392) is (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid.
What is the SMILES notation for (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid?
The canonical SMILES for (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid is C[C@@H](/C=C\C(=O)O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid?
The InChIKey is BQYJTPADGKWSNB-FUOZMLNRSA-N. The full InChI is InChI=1S/C11H22O3Si/c1-9(7-8-10(12)13)14-15(5,6)11(2,3)4/h7-9H,1-6H3,(H,12,13)/b8-7-/t9-/m0/s1.
What are the key properties of (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid?
(Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid has a molecular weight of 230.38 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoic acid is sourced from PubChem (CID 11701392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).