C20H22N4O3S — CID 1170145
N-(2,3-dimethylphenyl)-2-[[5-[(4-methoxyanilino)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 1170145) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[[5-[(4-methoxyanilino)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[[5-[(4-methoxyanilino)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1170145 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[[5-[(4-methoxyanilino)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(NCc2nnc(SCC(=O)Nc3cccc(C)c3C)o2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-13-5-4-6-17(14(13)2)22-18(25)12-28-20-24-23-19(27-20)11-21-15-7-9-16(26-3)10-8-15/h4-10,21H,11-12H2,1-3H3,(H,22,25) |
| InChIKey | LYQYCWUAAGIELK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|