About N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine
N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine (PubChem CID 117014700) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine |
| PubChem CID | 117014700 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine |
| SMILES | CC1CCNCCCN1CCCN(C)C |
| InChI | InChI=1S/C12H27N3/c1-12-6-8-13-7-4-10-15(12)11-5-9-14(2)3/h12-13H,4-11H2,1-3H3 |
| InChIKey | KLNNIDRBQKEGGT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine?
The IUPAC name of N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine (CID 117014700) is N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine.
What is the SMILES notation for N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine?
The canonical SMILES for N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine is CC1CCNCCCN1CCCN(C)C.
What is the InChIKey of N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine?
The InChIKey is KLNNIDRBQKEGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3/c1-12-6-8-13-7-4-10-15(12)11-5-9-14(2)3/h12-13H,4-11H2,1-3H3.
What are the key properties of N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine?
N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine has a molecular weight of 213.37 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-(2-methyl-1,5-diazocan-1-yl)propan-1-amine is sourced from PubChem (CID 117014700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).